How do you calculate methyl salicylate?
Methyl salicylate
- Formula: C8H8O3
- Molecular weight: 152.1473.
- IUPAC Standard InChI: InChI=1S/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3.
- IUPAC Standard InChIKey: OSWPMRLSEDHDFF-UHFFFAOYSA-N.
- CAS Registry Number: 119-36-8.
- Chemical structure:
What is the Colour of methyl salicylate?
colorless
Methyl salicylate is a liquid methyl ester of salicylic acid with a distinct characteristic odor. It is colorless or light pale in color, and commonly known as synthetic oil of wintergreen (made from the distillation of wintergreen leaves).
What is the difference between salicylic acid and methyl salicylate?
Methyl salicylate is rapidly hydrolyzed to salicylic acid, which has analgesic, antipyretic, and antiinflammatory effects. Methyl salicylate is used topically as a counter-irritant. Esterases in the skin rapidly hydrolyze salicylate esters to the active salicylic acid in both the epidermis and dermis.
Which is more polar salicylic acid or methyl salicylate?
The group -OH is more polar than the ester and thus salicylic acid is more polar than aspirin….Is methyl salicylate more polar than salicylic acid?
| CHEMISTRY Related Links | |
|---|---|
| Specific Heat Capacity | Nickel Atomic Number |
| Lead Atomic Mass | Aldol Condensation Reaction |
How does methyl salicylate work?
Menthol and methyl salicylate are known as counterirritants. They work by causing the skin to feel cool and then warm. These feelings on the skin distract you from feeling the aches/pains deeper in your muscles, joints, and tendons.
What is the mechanism of methyl salicylate formation?
When salicylic acid is heated with methyl alcohol, the carboxyl group of salicylic acid is esterified producing a strong-smelling liquid ester (methyl salicylate). an alcohol and a carboxylic acid. The reaction is reversible and uses an acid as a catalyst.
What is the mode of action of methyl salicylate?
Methyl Salicylate acts a counter rubefacient. It acts by stimulating the superficial afferent nerves from the same spinal segment that supplies the underlying painful muscles. The stimulation of these nerves causes vasodilation in that spinal segment and that reduces the cause of pain in the deeper muscles.
What is methyl salicylate used in?
For acute joint and muscular pain, methyl salicylate is used as a rubefacient and analgesic in deep heating liniments. It is used as a flavoring agent in chewing gums and mints in small concentrations and added as antiseptic in mouthwash solutions.
Why is methyl salicylate soluble in water?
Methyl salicylate (oil of wintergreen or wintergreen oil) is an organic compound with the formula C8H8O3. It is the methyl ester of salicylic acid….Methyl salicylate.
| Names | |
|---|---|
| Solubility in water | 0.639 g/L (21 °C) 0.697 g/L (30 °C) |
| Solubility | Miscible in organic solvents |
| Solubility in acetone | 10.1 g/g (30 °C) |
| Vapor pressure | 1 mmHg (54 °C) |
How does salicylate work?
It works by blocking nerve signals in your body. Methyl salicylate is a nonsteroidal anti-inflammatory drug (NSAID) in a group of drugs called salicylates (sa-LIS-il-ates). This medicine works by reducing substances in the body that cause pain and inflammation.