What is the molar mass of s2o7?
Disulfate ion
| PubChem CID | 177717 |
|---|---|
| Molecular Formula | O7S2-2 |
| Synonyms | Disulfate ion disulfate PYROSULFATE disulfate(2-) 16057-15-1 More… |
| Molecular Weight | 176.13 |
| Dates | Modify 2022-02-12 Create 2005-08-09 |
What is the name for s2o7?
In chemistry, disulfate or pyrosulfate is the anion with the molecular formula S. 2O 2− 7. Disulfate is the IUPAC name.
What compound is N2O6?
Nitrooxy nitrate
Nitrooxy nitrate | N2O6 – PubChem.
What is the oxidation number of S in s2o7 2?
Oxidation number of sulfur is six in S2O72- ion.
What is the empirical formula for N2O6?
Identification of Nitrooxy nitrate Chemical Compound
| Chemical Formula | N2O6 |
|---|---|
| IUPAC Name | nitrooxy nitrate |
| SMILES String | [O-][N+](=O)OO[N+]([O-])=O |
| InChI | InChI=1S/N2O6/c3-1(4)7-8-2(5)6 |
| InChIKey | XKJRYIVSCOBHBJ-UHFFFAOYSA-N |
What is the name of s2o3 2?
Thiosulfate Formula & Structure The molecular formula of thiosulfate is S2O32-. Thiosulfate has a central sulfur atom surrounded by three oxygen atoms and one sulfur atom.
What is the structure of s2o3 2?
S2O32- (Thiosulfate) Lewis Structure. Thiosulfate ion contains two sulfur atoms and three oxygen atoms. In lewis structure of S2O32- ion, there is -2 charge and oxygen atoms should hold them. Total valence electrons of sulfur and oxygen atoms are used to draw the structure.
What is S2O5 chemistry?
copper (II) nitrite. Name the compound CI3. carbon triodine. Name the compound S2O5. disulfur pentoxide.
What is s2o3 2 called?
Thiosulphate THIOSULFATE ION
Thiosulfate ion
| PubChem CID | 1084 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | O3S2-2 |
| Synonyms | Thiosulphate THIOSULFATE ION sulfurothioate UNII-LLT6XV39PY Thiosulfate (S2O32-) More… |
| Molecular Weight | 112.13 |
Is N2O6 a molecular formula?
Nitrooxy nitrate Formula – N2O6 – Over 100 million chemical compounds | Mol-Instincts.
What is the correct formula for Tetranitrogen monoxide?
It has a molecular formula N4O.